| Name | 4-Amino-4'-nitrodiphenyl ether |
| Synonyms | 4-(4-Nitrophenoxy)an 4-(4-NITROPHENOXY)ANILINE 4-(4-Nitrophenoxy)aniline p-(p-Nitrophenoxy)aniline 4-nitro-2aminodiphenytether 4-(4-Nitrophenoxy)benzenamine 4-nitro-2'-aminodiphenytether 4-AMINO-4'-NITRODIPHENYL ETHER 4-Amino-4'-nitrodiphenyl ether Benzenamine, 4-(4-nitrophenoxy)- 4-(4-nitrophenoxy)anilinium chloride |
| CAS | 6149-33-3 |
| EINECS | 228-159-3 |
| InChI | InChI=1/C12H10N2O3.ClH/c13-9-1-5-11(6-2-9)17-12-7-3-10(4-8-12)14(15)16;/h1-8H,13H2;1H |
| Molecular Formula | C12H10N2O3 |
| Molar Mass | 230.22 |
| Density | 1.322±0.06 g/cm3(Predicted) |
| Melting Point | 132 °C |
| Boling Point | 387.4±22.0 °C(Predicted) |
| Flash Point | 188.1°C |
| Solubility | soluble in Acetone |
| Vapor Presure | 3.31E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Orange to Brown to Dark red |
| pKa | 4.24±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R38 - Irritating to the skin R37 - Irritating to the respiratory system R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT, IRRITANT-H |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |